Preparing for the Joint Entrance Exam (JEE) can be a daunting task. With so many subjects to cover and so many topics to study, it can be challenging to know where to start. One essential topic in the JEE Mains syllabus is the Organic Chemistry: Basic Principles & Techniques. In this article, we will provide 50+ MCQ questions on the Organic Chemistry: Basic Principles & Techniques, along with detailed solutions to help you prepare for the JEE Mains exam.
These 50+ MCQ questions are selected by the experts of studyrate.in and these are more difficult questions, which will help you to better understand Organic Chemistry: Basic Principles & Techniques JEE Mains MCQ Questions with Answers.
Organic Chemistry: Basic Principles & Techniques JEE Mains MCQ
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH2CH(CH3)CH2CH3
a) 3-methylhexane
b) 2,2-dimethylpentane
c) 2,4-dimethylpentane
d) 2,3-dimethylbutane
What is the major product formed when butan-2-ol undergoes dehydration in the presence of concentrated sulfuric acid?
a) But-1-ene
b) But-2-ene
c) 2-methylpropene
d) Ethene
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH2COOH
a) Ethanoic acid
b) Acetic acid
c) Propanoic acid
d) Butanoic acid
Which of the following compounds is an example of a secondary alcohol?
a) Methanol
b) Ethanol
c) Propanol
d) Butanol
Which of the following reagents is used for the oxidation of primary alcohols to aldehydes?
a) KMnO4
b) H2SO4
c) PCC
d) NaOH
What is the major product formed when ethylbenzene undergoes catalytic hydrogenation?
a) Ethane
b) Benzene
c) Toluene
d) Cyclohexane
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH(Cl)CH2CH(CH3)2
a) 3-chloro-2,3-dimethylbutane
b) 2-chloro-3,3-dimethylbutane
c) 2-chloro-2,3-dimethylbutane
d) 2-chloro-2,2-dimethylbutane
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH2CH2CHO
a) Butanal
b) Butanone
c) Butanoic acid
d) Butanol
.
Which of the following is not a primary method of purification of organic compounds?
a) Distillation
b) Filtration
c) Crystallization
d) Chromatography
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH(CH3)CH2CH(CH3)CH2CH(CH3)2
a) 3,3-dimethylheptane
b) 2,5-dimethylhexane
c) 2,5,5-trimethylhexane
d) 3,4,4-trimethylheptane
Which of the following techniques is commonly used to separate and purify organic compounds based on their boiling points?
a) Chromatography
b) Distillation
c) Filtration
d) Crystallization
Which of the following reagents is used for the conversion of alkynes to cis-alkenes?
a) NaBH4
b) H2SO4
c) Lindlar catalyst
d) PBr3
What is the major product formed when propanoic acid undergoes decarboxylation?
a) Propane
b) Propanal
c) Ethane
d) Ethanol
Which of the following reagents is used for the conversion of primary alcohols to alkyl halides?
a) PCC
b) KMnO4
c) SOCl2
d) NaOH
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH2CH(CH3)CH2CHO
a) Pentanal
b) 2-pentanone
c) 3-pentanone
d) 3-methylbutanal
What is the major product formed when methylbenzene undergoes nitration with a mixture of concentrated nitric acid and concentrated sulfuric acid?
a) Toluene
b) Nitrotoluene
c) Benzene
d) Phenol
Which of the following techniques is commonly used to separate and purify organic compounds based on differences in their solubility in a mobile phase and a stationary phase?
a) Chromatography
b) Distillation
c) Filtration
d) Crystallization
What is the major product formed when ethanal undergoes reduction in the presence of NaBH4?
a) Ethanol
b) Ethene
c) Propanal
d) Propane
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH2CH2COCH3
a) Butanone
b) Propanal
c) Pentan-2-one
d) Butanoic acid
Which of the following reagents is used for the conversion of aldehydes to primary alcohols?
a) LiAlH4
b) H2SO4
c) NaOH
d) PCC
What is the major product formed when ethene undergoes bromination?
a) Ethane
b) 1,2-dibromoethane
c) 1,1-dibromoethane
d) 1-bromoethene
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH2CH(CH3)2
a) 2,2-dimethylbutane
b) 2-methylpentane
c) 3-methylpentane
d) 2,3-dimethylbutane
Which of the following techniques is commonly used to separate and purify organic compounds based on their different rates of migration on a solid stationary phase?
a) Chromatography
b) Distillation
c) Filtration
d) Crystallization
What is the major product formed when ethanol undergoes oxidation in the presence of acidified potassium dichromate (K2Cr2O7)?
a) Ethane
b) Ethene
c) Ethanal
d) Ethanoic acid
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH2CH2NH2
a) Ethanamine
b) Ethylamine
c) Butanamine
d) Propanamine
What is the major product formed when ethene reacts with hydrogen bromide (HBr)?
a) Ethane
b) 1-bromoethene
c) 2-bromoethene
d) 1,2-dibromoethane
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH2COCH2CH3
a) 2-butanone
b) Butanoic acid
c) Ethyl methyl ketone
d) Propionic acid
Which of the following reagents is used for the conversion of alkyl halides to alcohols?
a) PCC
b) NaOH
c) LiAlH4
d) H2SO4
What is the major product formed when ethene reacts with chlorine (Cl2)?
a) Ethane
b) 1,2-dichloroethane
c) 1,1-dichloroethane
d) 1-chloroethene
Which of the following is the correct IUPAC name for the compound shown below?
CH3CH2COOCH2CH3
a) Ethyl ethanoate
b) Ethyl butanoate
c) Butyl ethanoate
d) Butyl butanoate
We hope there JEE MCQ of Class 11 Organic Chemistry: Basic Principles & Techniques will help you to score an excellent rank in JEE Mains and Advanced. If you have any queries feel free to write in the comments section. We at Study Rate are always ready to serve our students.